C20H19N3O5S2 — CID 26248424
N-[2-[[[3-(methoxymethyl)benzoyl]amino]carbamoyl]phenyl]thiophene-2-sulfonamide (PubChem CID 26248424) has the molecular formula C20H19N3O5S2 and a molecular weight of 445.52 g/mol. Its IUPAC name is N-[2-[[[3-(methoxymethyl)benzoyl]amino]carbamoyl]phenyl]thiophene-2-sulfonamide.
| Compound Name | N-[2-[[[3-(methoxymethyl)benzoyl]amino]carbamoyl]phenyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 26248424 |
| Molecular Formula | C20H19N3O5S2 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.08 |
| IUPAC Name | N-[2-[[[3-(methoxymethyl)benzoyl]amino]carbamoyl]phenyl]thiophene-2-sulfonamide |
| SMILES | COCc1cccc(C(=O)NNC(=O)c2ccccc2NS(=O)(=O)c2cccs2)c1 |
| InChI | InChI=1S/C20H19N3O5S2/c1-28-13-14-6-4-7-15(12-14)19(24)21-22-20(25)16-8-2-3-9-17(16)23-30(26,27)18-10-5-11-29-18/h2-12,23H,13H2,1H3,(H,21,24)(H,22,25) |
| InChIKey | YQTKHUCQAVEFRD-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|