C19H15Cl2N3O4S2 — CID 25497195
N-[2-[[[2-(2,4-dichlorophenyl)acetyl]amino]carbamoyl]phenyl]thiophene-2-sulfonamide (PubChem CID 25497195) has the molecular formula C19H15Cl2N3O4S2 and a molecular weight of 484.39 g/mol. Its IUPAC name is N-[2-[[[2-(2,4-dichlorophenyl)acetyl]amino]carbamoyl]phenyl]thiophene-2-sulfonamide.
| Compound Name | N-[2-[[[2-(2,4-dichlorophenyl)acetyl]amino]carbamoyl]phenyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 25497195 |
| Molecular Formula | C19H15Cl2N3O4S2 |
| Molecular Weight | 484.39 g/mol |
| Exact Mass | 482.99 |
| IUPAC Name | N-[2-[[[2-(2,4-dichlorophenyl)acetyl]amino]carbamoyl]phenyl]thiophene-2-sulfonamide |
| SMILES | O=C(Cc1ccc(Cl)cc1Cl)NNC(=O)c1ccccc1NS(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C19H15Cl2N3O4S2/c20-13-8-7-12(15(21)11-13)10-17(25)22-23-19(26)14-4-1-2-5-16(14)24-30(27,28)18-6-3-9-29-18/h1-9,11,24H,10H2,(H,22,25)(H,23,26) |
| InChIKey | DJIFWDYMZWSFLC-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.39 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|