C19H23N3O4S2 — CID 46652903
N-[2-[[(2-cyclohexylacetyl)amino]carbamoyl]phenyl]thiophene-2-sulfonamide (PubChem CID 46652903) has the molecular formula C19H23N3O4S2 and a molecular weight of 421.54 g/mol. Its IUPAC name is N-[2-[[(2-cyclohexylacetyl)amino]carbamoyl]phenyl]thiophene-2-sulfonamide.
| Compound Name | N-[2-[[(2-cyclohexylacetyl)amino]carbamoyl]phenyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 46652903 |
| Molecular Formula | C19H23N3O4S2 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.11 |
| IUPAC Name | N-[2-[[(2-cyclohexylacetyl)amino]carbamoyl]phenyl]thiophene-2-sulfonamide |
| SMILES | O=C(CC1CCCCC1)NNC(=O)c1ccccc1NS(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C19H23N3O4S2/c23-17(13-14-7-2-1-3-8-14)20-21-19(24)15-9-4-5-10-16(15)22-28(25,26)18-11-6-12-27-18/h4-6,9-12,14,22H,1-3,7-8,13H2,(H,20,23)(H,21,24) |
| InChIKey | KRDFTZGJBWHHSB-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|