C21H24N2O3S2 — CID 5064484
N-(1-adamantyl)-2-(thiophen-2-ylsulfonylamino)benzamide (PubChem CID 5064484) has the molecular formula C21H24N2O3S2 and a molecular weight of 416.57 g/mol. Its IUPAC name is N-(1-adamantyl)-2-(thiophen-2-ylsulfonylamino)benzamide.
| Compound Name | N-(1-adamantyl)-2-(thiophen-2-ylsulfonylamino)benzamide |
|---|---|
| PubChem CID | 5064484 |
| Molecular Formula | C21H24N2O3S2 |
| Molecular Weight | 416.57 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | N-(1-adamantyl)-2-(thiophen-2-ylsulfonylamino)benzamide |
| SMILES | O=C(NC12CC3CC(CC(C3)C1)C2)c1ccccc1NS(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C21H24N2O3S2/c24-20(22-21-11-14-8-15(12-21)10-16(9-14)13-21)17-4-1-2-5-18(17)23-28(25,26)19-6-3-7-27-19/h1-7,14-16,23H,8-13H2,(H,22,24) |
| InChIKey | KQAMXEREHAPPFD-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.57 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |