C22H21N3O4S2 — CID 27698726
N-[2-[(5,6,7,8-tetrahydronaphthalene-2-carbonylamino)carbamoyl]phenyl]thiophene-2-sulfonamide (PubChem CID 27698726) has the molecular formula C22H21N3O4S2 and a molecular weight of 455.56 g/mol. Its IUPAC name is N-[2-[(5,6,7,8-tetrahydronaphthalene-2-carbonylamino)carbamoyl]phenyl]thiophene-2-sulfonamide.
| Compound Name | N-[2-[(5,6,7,8-tetrahydronaphthalene-2-carbonylamino)carbamoyl]phenyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 27698726 |
| Molecular Formula | C22H21N3O4S2 |
| Molecular Weight | 455.56 g/mol |
| Exact Mass | 455.10 |
| IUPAC Name | N-[2-[(5,6,7,8-tetrahydronaphthalene-2-carbonylamino)carbamoyl]phenyl]thiophene-2-sulfonamide |
| SMILES | O=C(NNC(=O)c1ccccc1NS(=O)(=O)c1cccs1)c1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C22H21N3O4S2/c26-21(17-12-11-15-6-1-2-7-16(15)14-17)23-24-22(27)18-8-3-4-9-19(18)25-31(28,29)20-10-5-13-30-20/h3-5,8-14,25H,1-2,6-7H2,(H,23,26)(H,24,27) |
| InChIKey | VGDAYTPJGVHWDQ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.56 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|