C16H14N4O5S2 — CID 31800733
N-[2-[[(3-methyl-1,2-oxazole-5-carbonyl)amino]carbamoyl]phenyl]thiophene-2-sulfonamide (PubChem CID 31800733) has the molecular formula C16H14N4O5S2 and a molecular weight of 406.45 g/mol. Its IUPAC name is N-[2-[[(3-methyl-1,2-oxazole-5-carbonyl)amino]carbamoyl]phenyl]thiophene-2-sulfonamide.
| Compound Name | N-[2-[[(3-methyl-1,2-oxazole-5-carbonyl)amino]carbamoyl]phenyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 31800733 |
| Molecular Formula | C16H14N4O5S2 |
| Molecular Weight | 406.45 g/mol |
| Exact Mass | 406.04 |
| IUPAC Name | N-[2-[[(3-methyl-1,2-oxazole-5-carbonyl)amino]carbamoyl]phenyl]thiophene-2-sulfonamide |
| SMILES | Cc1cc(C(=O)NNC(=O)c2ccccc2NS(=O)(=O)c2cccs2)on1 |
| InChI | InChI=1S/C16H14N4O5S2/c1-10-9-13(25-19-10)16(22)18-17-15(21)11-5-2-3-6-12(11)20-27(23,24)14-7-4-8-26-14/h2-9,20H,1H3,(H,17,21)(H,18,22) |
| InChIKey | JZDGFSMMXUZHPT-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 130.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.45 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|