C21H21N3O4S3 — CID 55792346
N-[2-[(2-benzylsulfanylpropanoylamino)carbamoyl]phenyl]thiophene-2-sulfonamide (PubChem CID 55792346) has the molecular formula C21H21N3O4S3 and a molecular weight of 475.62 g/mol. Its IUPAC name is N-[2-[(2-benzylsulfanylpropanoylamino)carbamoyl]phenyl]thiophene-2-sulfonamide.
| Compound Name | N-[2-[(2-benzylsulfanylpropanoylamino)carbamoyl]phenyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 55792346 |
| Molecular Formula | C21H21N3O4S3 |
| Molecular Weight | 475.62 g/mol |
| Exact Mass | 475.07 |
| IUPAC Name | N-[2-[(2-benzylsulfanylpropanoylamino)carbamoyl]phenyl]thiophene-2-sulfonamide |
| SMILES | CC(SCc1ccccc1)C(=O)NNC(=O)c1ccccc1NS(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C21H21N3O4S3/c1-15(30-14-16-8-3-2-4-9-16)20(25)22-23-21(26)17-10-5-6-11-18(17)24-31(27,28)19-12-7-13-29-19/h2-13,15,24H,14H2,1H3,(H,22,25)(H,23,26) |
| InChIKey | FZDCBTHEAMGMHM-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.62 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|