C17H21N3O3S2 — CID 7392702
N-[(Z)-[(3S)-3-methylpentan-2-ylidene]amino]-2-(thiophen-2-ylsulfonylamino)benzamide (PubChem CID 7392702) has the molecular formula C17H21N3O3S2 and a molecular weight of 379.51 g/mol. Its IUPAC name is N-[(Z)-[(3S)-3-methylpentan-2-ylidene]amino]-2-(thiophen-2-ylsulfonylamino)benzamide.
| Compound Name | N-[(Z)-[(3S)-3-methylpentan-2-ylidene]amino]-2-(thiophen-2-ylsulfonylamino)benzamide |
|---|---|
| PubChem CID | 7392702 |
| Molecular Formula | C17H21N3O3S2 |
| Molecular Weight | 379.51 g/mol |
| Exact Mass | 379.10 |
| IUPAC Name | N-[(Z)-[(3S)-3-methylpentan-2-ylidene]amino]-2-(thiophen-2-ylsulfonylamino)benzamide |
| SMILES | CC[C@H](C)/C(C)=N\NC(=O)c1ccccc1NS(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C17H21N3O3S2/c1-4-12(2)13(3)18-19-17(21)14-8-5-6-9-15(14)20-25(22,23)16-10-7-11-24-16/h5-12,20H,4H2,1-3H3,(H,19,21)/b18-13-/t12-/m0/s1 |
| InChIKey | BMQCZEIESKMGDN-JYRXDZGKSA-N |
| XLogP | 3.70 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.51 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|