C21H17N3O4S2 — CID 4569049
N-[1-(1-benzofuran-2-yl)ethylideneamino]-2-(thiophen-2-ylsulfonylamino)benzamide (PubChem CID 4569049) has the molecular formula C21H17N3O4S2 and a molecular weight of 439.52 g/mol. Its IUPAC name is N-[1-(1-benzofuran-2-yl)ethylideneamino]-2-(thiophen-2-ylsulfonylamino)benzamide.
| Compound Name | N-[1-(1-benzofuran-2-yl)ethylideneamino]-2-(thiophen-2-ylsulfonylamino)benzamide |
|---|---|
| PubChem CID | 4569049 |
| Molecular Formula | C21H17N3O4S2 |
| Molecular Weight | 439.52 g/mol |
| Exact Mass | 439.07 |
| IUPAC Name | N-[1-(1-benzofuran-2-yl)ethylideneamino]-2-(thiophen-2-ylsulfonylamino)benzamide |
| SMILES | CC(=NNC(=O)c1ccccc1NS(=O)(=O)c1cccs1)c1cc2ccccc2o1 |
| InChI | InChI=1S/C21H17N3O4S2/c1-14(19-13-15-7-2-5-10-18(15)28-19)22-23-21(25)16-8-3-4-9-17(16)24-30(26,27)20-11-6-12-29-20/h2-13,24H,1H3,(H,23,25) |
| InChIKey | PMVYUNPRRZCALB-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 100.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.52 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|