C17H15N3O4S — CID 163360864
N-[(E)-1-(1-benzofuran-2-yl)ethylideneamino]-4-sulfamoylbenzamide (PubChem CID 163360864) has the molecular formula C17H15N3O4S and a molecular weight of 357.39 g/mol. Its IUPAC name is N-[(E)-1-(1-benzofuran-2-yl)ethylideneamino]-4-sulfamoylbenzamide.
| Compound Name | N-[(E)-1-(1-benzofuran-2-yl)ethylideneamino]-4-sulfamoylbenzamide |
|---|---|
| PubChem CID | 163360864 |
| Molecular Formula | C17H15N3O4S |
| Molecular Weight | 357.39 g/mol |
| Exact Mass | 357.08 |
| IUPAC Name | N-[(E)-1-(1-benzofuran-2-yl)ethylideneamino]-4-sulfamoylbenzamide |
| SMILES | C/C(=N\NC(=O)c1ccc(S(N)(=O)=O)cc1)c1cc2ccccc2o1 |
| InChI | InChI=1S/C17H15N3O4S/c1-11(16-10-13-4-2-3-5-15(13)24-16)19-20-17(21)12-6-8-14(9-7-12)25(18,22)23/h2-10H,1H3,(H,20,21)(H2,18,22,23)/b19-11+ |
| InChIKey | PXBUSPLTIHIFHF-YBFXNURJSA-N |
| XLogP | 2.23 |
| TPSA | 114.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.39 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|