C21H18N4O4S2 — CID 172923751
N-[(E)-1-[3-(cyanomethoxy)phenyl]ethylideneamino]-2-(thiophen-2-ylsulfonylamino)benzamide (PubChem CID 172923751) has the molecular formula C21H18N4O4S2 and a molecular weight of 454.53 g/mol. Its IUPAC name is N-[(E)-1-[3-(cyanomethoxy)phenyl]ethylideneamino]-2-(thiophen-2-ylsulfonylamino)benzamide.
| Compound Name | N-[(E)-1-[3-(cyanomethoxy)phenyl]ethylideneamino]-2-(thiophen-2-ylsulfonylamino)benzamide |
|---|---|
| PubChem CID | 172923751 |
| Molecular Formula | C21H18N4O4S2 |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.08 |
| IUPAC Name | N-[(E)-1-[3-(cyanomethoxy)phenyl]ethylideneamino]-2-(thiophen-2-ylsulfonylamino)benzamide |
| SMILES | C/C(=N\NC(=O)c1ccccc1NS(=O)(=O)c1cccs1)c1cccc(OCC#N)c1 |
| InChI | InChI=1S/C21H18N4O4S2/c1-15(16-6-4-7-17(14-16)29-12-11-22)23-24-21(26)18-8-2-3-9-19(18)25-31(27,28)20-10-5-13-30-20/h2-10,13-14,25H,12H2,1H3,(H,24,26)/b23-15+ |
| InChIKey | LZDFGYJABFQZNN-HZHRSRAPSA-N |
| XLogP | 3.61 |
| TPSA | 120.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|