C22H23N5O5S2 — CID 172923781
N-[(E)-1-[4-[2-(dimethylamino)-2-oxoethoxy]phenyl]ethylideneamino]-3-(thiophen-2-ylsulfonylamino)pyridine-4-carboxamide (PubChem CID 172923781) has the molecular formula C22H23N5O5S2 and a molecular weight of 501.59 g/mol. Its IUPAC name is N-[(E)-1-[4-[2-(dimethylamino)-2-oxoethoxy]phenyl]ethylideneamino]-3-(thiophen-2-ylsulfonylamino)pyridine-4-carboxamide.
| Compound Name | N-[(E)-1-[4-[2-(dimethylamino)-2-oxoethoxy]phenyl]ethylideneamino]-3-(thiophen-2-ylsulfonylamino)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 172923781 |
| Molecular Formula | C22H23N5O5S2 |
| Molecular Weight | 501.59 g/mol |
| Exact Mass | 501.11 |
| IUPAC Name | N-[(E)-1-[4-[2-(dimethylamino)-2-oxoethoxy]phenyl]ethylideneamino]-3-(thiophen-2-ylsulfonylamino)pyridine-4-carboxamide |
| SMILES | C/C(=N\NC(=O)c1ccncc1NS(=O)(=O)c1cccs1)c1ccc(OCC(=O)N(C)C)cc1 |
| InChI | InChI=1S/C22H23N5O5S2/c1-15(16-6-8-17(9-7-16)32-14-20(28)27(2)3)24-25-22(29)18-10-11-23-13-19(18)26-34(30,31)21-5-4-12-33-21/h4-13,26H,14H2,1-3H3,(H,25,29)/b24-15+ |
| InChIKey | NMSDMAITWNKJPW-BUVRLJJBSA-N |
| XLogP | 2.56 |
| TPSA | 130.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.59 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|