C22H23N5O6S3 — CID 172923742
N-[(E)-1-(3-morpholin-4-ylsulfonylphenyl)ethylideneamino]-3-(thiophen-2-ylsulfonylamino)pyridine-4-carboxamide (PubChem CID 172923742) has the molecular formula C22H23N5O6S3 and a molecular weight of 549.66 g/mol. Its IUPAC name is N-[(E)-1-(3-morpholin-4-ylsulfonylphenyl)ethylideneamino]-3-(thiophen-2-ylsulfonylamino)pyridine-4-carboxamide.
| Compound Name | N-[(E)-1-(3-morpholin-4-ylsulfonylphenyl)ethylideneamino]-3-(thiophen-2-ylsulfonylamino)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 172923742 |
| Molecular Formula | C22H23N5O6S3 |
| Molecular Weight | 549.66 g/mol |
| Exact Mass | 549.08 |
| IUPAC Name | N-[(E)-1-(3-morpholin-4-ylsulfonylphenyl)ethylideneamino]-3-(thiophen-2-ylsulfonylamino)pyridine-4-carboxamide |
| SMILES | C/C(=N\NC(=O)c1ccncc1NS(=O)(=O)c1cccs1)c1cccc(S(=O)(=O)N2CCOCC2)c1 |
| InChI | InChI=1S/C22H23N5O6S3/c1-16(17-4-2-5-18(14-17)36(31,32)27-9-11-33-12-10-27)24-25-22(28)19-7-8-23-15-20(19)26-35(29,30)21-6-3-13-34-21/h2-8,13-15,26H,9-12H2,1H3,(H,25,28)/b24-16+ |
| InChIKey | ACJUXCAZUQKILP-LFVJCYFKSA-N |
| XLogP | 2.12 |
| TPSA | 147.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.66 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|