C20H21N5O6S3 — CID 172923739
N-[(E)-1-[3-(2-hydroxyethylsulfamoyl)phenyl]ethylideneamino]-3-(thiophen-2-ylsulfonylamino)pyridine-4-carboxamide (PubChem CID 172923739) has the molecular formula C20H21N5O6S3 and a molecular weight of 523.62 g/mol. Its IUPAC name is N-[(E)-1-[3-(2-hydroxyethylsulfamoyl)phenyl]ethylideneamino]-3-(thiophen-2-ylsulfonylamino)pyridine-4-carboxamide.
| Compound Name | N-[(E)-1-[3-(2-hydroxyethylsulfamoyl)phenyl]ethylideneamino]-3-(thiophen-2-ylsulfonylamino)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 172923739 |
| Molecular Formula | C20H21N5O6S3 |
| Molecular Weight | 523.62 g/mol |
| Exact Mass | 523.07 |
| IUPAC Name | N-[(E)-1-[3-(2-hydroxyethylsulfamoyl)phenyl]ethylideneamino]-3-(thiophen-2-ylsulfonylamino)pyridine-4-carboxamide |
| SMILES | C/C(=N\NC(=O)c1ccncc1NS(=O)(=O)c1cccs1)c1cccc(S(=O)(=O)NCCO)c1 |
| InChI | InChI=1S/C20H21N5O6S3/c1-14(15-4-2-5-16(12-15)33(28,29)22-9-10-26)23-24-20(27)17-7-8-21-13-18(17)25-34(30,31)19-6-3-11-32-19/h2-8,11-13,22,25-26H,9-10H2,1H3,(H,24,27)/b23-14+ |
| InChIKey | NEQJJZKKXXCIIQ-OEAKJJBVSA-N |
| XLogP | 1.37 |
| TPSA | 166.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.62 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|