C21H23N5O6S3 — CID 171140629
N-[1-[3-(2-methoxyethylsulfamoyl)phenyl]ethylideneamino]-3-(thiophen-2-ylsulfonylamino)pyridine-4-carboxamide (PubChem CID 171140629) has the molecular formula C21H23N5O6S3 and a molecular weight of 537.65 g/mol. Its IUPAC name is N-[1-[3-(2-methoxyethylsulfamoyl)phenyl]ethylideneamino]-3-(thiophen-2-ylsulfonylamino)pyridine-4-carboxamide.
| Compound Name | N-[1-[3-(2-methoxyethylsulfamoyl)phenyl]ethylideneamino]-3-(thiophen-2-ylsulfonylamino)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 171140629 |
| Molecular Formula | C21H23N5O6S3 |
| Molecular Weight | 537.65 g/mol |
| Exact Mass | 537.08 |
| IUPAC Name | N-[1-[3-(2-methoxyethylsulfamoyl)phenyl]ethylideneamino]-3-(thiophen-2-ylsulfonylamino)pyridine-4-carboxamide |
| SMILES | COCCNS(=O)(=O)c1cccc(C(C)=NNC(=O)c2ccncc2NS(=O)(=O)c2cccs2)c1 |
| InChI | InChI=1S/C21H23N5O6S3/c1-15(16-5-3-6-17(13-16)34(28,29)23-10-11-32-2)24-25-21(27)18-8-9-22-14-19(18)26-35(30,31)20-7-4-12-33-20/h3-9,12-14,23,26H,10-11H2,1-2H3,(H,25,27) |
| InChIKey | XVVPGARKTNFKMK-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 155.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.65 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|