C23H26N6O5S3 — CID 172923743
N-[(E)-1-[3-(4-methylpiperazin-1-yl)sulfonylphenyl]ethylideneamino]-4-(thiophen-2-ylsulfonylamino)pyridine-3-carboxamide (PubChem CID 172923743) has the molecular formula C23H26N6O5S3 and a molecular weight of 562.70 g/mol. Its IUPAC name is N-[(E)-1-[3-(4-methylpiperazin-1-yl)sulfonylphenyl]ethylideneamino]-4-(thiophen-2-ylsulfonylamino)pyridine-3-carboxamide.
| Compound Name | N-[(E)-1-[3-(4-methylpiperazin-1-yl)sulfonylphenyl]ethylideneamino]-4-(thiophen-2-ylsulfonylamino)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 172923743 |
| Molecular Formula | C23H26N6O5S3 |
| Molecular Weight | 562.70 g/mol |
| Exact Mass | 562.11 |
| IUPAC Name | N-[(E)-1-[3-(4-methylpiperazin-1-yl)sulfonylphenyl]ethylideneamino]-4-(thiophen-2-ylsulfonylamino)pyridine-3-carboxamide |
| SMILES | C/C(=N\NC(=O)c1cnccc1NS(=O)(=O)c1cccs1)c1cccc(S(=O)(=O)N2CCN(C)CC2)c1 |
| InChI | InChI=1S/C23H26N6O5S3/c1-17(18-5-3-6-19(15-18)37(33,34)29-12-10-28(2)11-13-29)25-26-23(30)20-16-24-9-8-21(20)27-36(31,32)22-7-4-14-35-22/h3-9,14-16H,10-13H2,1-2H3,(H,24,27)(H,26,30)/b25-17+ |
| InChIKey | DFWZIOHSPOPHOD-KOEQRZSOSA-N |
| XLogP | 2.03 |
| TPSA | 141.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.70 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|