C22H24N4O3S2 — CID 171140673
N-[1-(4-tert-butylphenyl)ethylideneamino]-3-(thiophen-2-ylsulfonylamino)pyridine-4-carboxamide (PubChem CID 171140673) has the molecular formula C22H24N4O3S2 and a molecular weight of 456.59 g/mol. Its IUPAC name is N-[1-(4-tert-butylphenyl)ethylideneamino]-3-(thiophen-2-ylsulfonylamino)pyridine-4-carboxamide.
| Compound Name | N-[1-(4-tert-butylphenyl)ethylideneamino]-3-(thiophen-2-ylsulfonylamino)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 171140673 |
| Molecular Formula | C22H24N4O3S2 |
| Molecular Weight | 456.59 g/mol |
| Exact Mass | 456.13 |
| IUPAC Name | N-[1-(4-tert-butylphenyl)ethylideneamino]-3-(thiophen-2-ylsulfonylamino)pyridine-4-carboxamide |
| SMILES | CC(=NNC(=O)c1ccncc1NS(=O)(=O)c1cccs1)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C22H24N4O3S2/c1-15(16-7-9-17(10-8-16)22(2,3)4)24-25-21(27)18-11-12-23-14-19(18)26-31(28,29)20-6-5-13-30-20/h5-14,26H,1-4H3,(H,25,27) |
| InChIKey | NGIWBAHZEKJFIB-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.59 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|