C19H15Cl2N3O4S2 — CID 135679012
N-[(E)-1-(3,5-dichloro-2-hydroxyphenyl)ethylideneamino]-2-(thiophen-2-ylsulfonylamino)benzamide (PubChem CID 135679012) has the molecular formula C19H15Cl2N3O4S2 and a molecular weight of 484.39 g/mol. Its IUPAC name is N-[(E)-1-(3,5-dichloro-2-hydroxyphenyl)ethylideneamino]-2-(thiophen-2-ylsulfonylamino)benzamide.
| Compound Name | N-[(E)-1-(3,5-dichloro-2-hydroxyphenyl)ethylideneamino]-2-(thiophen-2-ylsulfonylamino)benzamide |
|---|---|
| PubChem CID | 135679012 |
| Molecular Formula | C19H15Cl2N3O4S2 |
| Molecular Weight | 484.39 g/mol |
| Exact Mass | 482.99 |
| IUPAC Name | N-[(E)-1-(3,5-dichloro-2-hydroxyphenyl)ethylideneamino]-2-(thiophen-2-ylsulfonylamino)benzamide |
| SMILES | C/C(=N\NC(=O)c1ccccc1NS(=O)(=O)c1cccs1)c1cc(Cl)cc(Cl)c1O |
| InChI | InChI=1S/C19H15Cl2N3O4S2/c1-11(14-9-12(20)10-15(21)18(14)25)22-23-19(26)13-5-2-3-6-16(13)24-30(27,28)17-7-4-8-29-17/h2-10,24-25H,1H3,(H,23,26)/b22-11+ |
| InChIKey | HZROVCHKJPCVOD-SSDVNMTOSA-N |
| XLogP | 4.72 |
| TPSA | 107.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.39 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|