C20H18FN3O4S2 — CID 3451346
N-[1-(5-fluoro-2-hydroxyphenyl)propylideneamino]-2-(thiophen-2-ylsulfonylamino)benzamide (PubChem CID 3451346) has the molecular formula C20H18FN3O4S2 and a molecular weight of 447.51 g/mol. Its IUPAC name is N-[1-(5-fluoro-2-hydroxyphenyl)propylideneamino]-2-(thiophen-2-ylsulfonylamino)benzamide.
| Compound Name | N-[1-(5-fluoro-2-hydroxyphenyl)propylideneamino]-2-(thiophen-2-ylsulfonylamino)benzamide |
|---|---|
| PubChem CID | 3451346 |
| Molecular Formula | C20H18FN3O4S2 |
| Molecular Weight | 447.51 g/mol |
| Exact Mass | 447.07 |
| IUPAC Name | N-[1-(5-fluoro-2-hydroxyphenyl)propylideneamino]-2-(thiophen-2-ylsulfonylamino)benzamide |
| SMILES | CCC(=NNC(=O)c1ccccc1NS(=O)(=O)c1cccs1)c1cc(F)ccc1O |
| InChI | InChI=1S/C20H18FN3O4S2/c1-2-16(15-12-13(21)9-10-18(15)25)22-23-20(26)14-6-3-4-7-17(14)24-30(27,28)19-8-5-11-29-19/h3-12,24-25H,2H2,1H3,(H,23,26) |
| InChIKey | CIELBNFDOWJQTP-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 107.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.51 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|