C17H11Br2FN2O3S2 — CID 2473604
N-(2,6-dibromo-4-fluorophenyl)-2-(thiophen-2-ylsulfonylamino)benzamide (PubChem CID 2473604) has the molecular formula C17H11Br2FN2O3S2 and a molecular weight of 534.23 g/mol. Its IUPAC name is N-(2,6-dibromo-4-fluorophenyl)-2-(thiophen-2-ylsulfonylamino)benzamide.
| Compound Name | N-(2,6-dibromo-4-fluorophenyl)-2-(thiophen-2-ylsulfonylamino)benzamide |
|---|---|
| PubChem CID | 2473604 |
| Molecular Formula | C17H11Br2FN2O3S2 |
| Molecular Weight | 534.23 g/mol |
| Exact Mass | 531.86 |
| IUPAC Name | N-(2,6-dibromo-4-fluorophenyl)-2-(thiophen-2-ylsulfonylamino)benzamide |
| SMILES | O=C(Nc1c(Br)cc(F)cc1Br)c1ccccc1NS(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C17H11Br2FN2O3S2/c18-12-8-10(20)9-13(19)16(12)21-17(23)11-4-1-2-5-14(11)22-27(24,25)15-6-3-7-26-15/h1-9,22H,(H,21,23) |
| InChIKey | MDRMTMLPQMANCI-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.23 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |