C13H11N5O3S2 — CID 25038247
2-(thiophen-2-ylsulfonylamino)-N-(1H-1,2,4-triazol-5-yl)benzamide (PubChem CID 25038247) has the molecular formula C13H11N5O3S2 and a molecular weight of 349.40 g/mol. Its IUPAC name is 2-(thiophen-2-ylsulfonylamino)-N-(1H-1,2,4-triazol-5-yl)benzamide.
| Compound Name | 2-(thiophen-2-ylsulfonylamino)-N-(1H-1,2,4-triazol-5-yl)benzamide |
|---|---|
| PubChem CID | 25038247 |
| Molecular Formula | C13H11N5O3S2 |
| Molecular Weight | 349.40 g/mol |
| Exact Mass | 349.03 |
| IUPAC Name | 2-(thiophen-2-ylsulfonylamino)-N-(1H-1,2,4-triazol-5-yl)benzamide |
| SMILES | O=C(Nc1ncn[nH]1)c1ccccc1NS(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C13H11N5O3S2/c19-12(16-13-14-8-15-17-13)9-4-1-2-5-10(9)18-23(20,21)11-6-3-7-22-11/h1-8,18H,(H2,14,15,16,17,19) |
| InChIKey | NHIIUEUHXITRSX-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.40 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |