C22H17FN4O4S2 — CID 39459100
N-[2-[[(7-fluoro-2-methylquinoline-4-carbonyl)amino]carbamoyl]phenyl]thiophene-2-sulfonamide (PubChem CID 39459100) has the molecular formula C22H17FN4O4S2 and a molecular weight of 484.53 g/mol. Its IUPAC name is N-[2-[[(7-fluoro-2-methylquinoline-4-carbonyl)amino]carbamoyl]phenyl]thiophene-2-sulfonamide.
| Compound Name | N-[2-[[(7-fluoro-2-methylquinoline-4-carbonyl)amino]carbamoyl]phenyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 39459100 |
| Molecular Formula | C22H17FN4O4S2 |
| Molecular Weight | 484.53 g/mol |
| Exact Mass | 484.07 |
| IUPAC Name | N-[2-[[(7-fluoro-2-methylquinoline-4-carbonyl)amino]carbamoyl]phenyl]thiophene-2-sulfonamide |
| SMILES | Cc1cc(C(=O)NNC(=O)c2ccccc2NS(=O)(=O)c2cccs2)c2ccc(F)cc2n1 |
| InChI | InChI=1S/C22H17FN4O4S2/c1-13-11-17(15-9-8-14(23)12-19(15)24-13)22(29)26-25-21(28)16-5-2-3-6-18(16)27-33(30,31)20-7-4-10-32-20/h2-12,27H,1H3,(H,25,28)(H,26,29) |
| InChIKey | UHGGTHDMSLUJNB-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 117.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.53 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|