C20H16FN3O5S3 — CID 2694137
N-[2-[[(6-fluoro-1,1-dioxo-2H-thiochromen-4-yl)amino]carbamoyl]phenyl]thiophene-2-sulfonamide (PubChem CID 2694137) has the molecular formula C20H16FN3O5S3 and a molecular weight of 493.56 g/mol. Its IUPAC name is N-[2-[[(6-fluoro-1,1-dioxo-2H-thiochromen-4-yl)amino]carbamoyl]phenyl]thiophene-2-sulfonamide.
| Compound Name | N-[2-[[(6-fluoro-1,1-dioxo-2H-thiochromen-4-yl)amino]carbamoyl]phenyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 2694137 |
| Molecular Formula | C20H16FN3O5S3 |
| Molecular Weight | 493.56 g/mol |
| Exact Mass | 493.02 |
| IUPAC Name | N-[2-[[(6-fluoro-1,1-dioxo-2H-thiochromen-4-yl)amino]carbamoyl]phenyl]thiophene-2-sulfonamide |
| SMILES | O=C(NNC1=CCS(=O)(=O)c2ccc(F)cc21)c1ccccc1NS(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C20H16FN3O5S3/c21-13-7-8-18-15(12-13)16(9-11-31(18,26)27)22-23-20(25)14-4-1-2-5-17(14)24-32(28,29)19-6-3-10-30-19/h1-10,12,22,24H,11H2,(H,23,25) |
| InChIKey | XDHOAJAGGDDFIF-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 121.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.56 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|