C19H21N3O4S2 — CID 2352679
N-[2-[[(5,5-dimethyl-3-oxocyclohexen-1-yl)amino]carbamoyl]phenyl]thiophene-2-sulfonamide (PubChem CID 2352679) has the molecular formula C19H21N3O4S2 and a molecular weight of 419.53 g/mol. Its IUPAC name is N-[2-[[(5,5-dimethyl-3-oxocyclohexen-1-yl)amino]carbamoyl]phenyl]thiophene-2-sulfonamide.
| Compound Name | N-[2-[[(5,5-dimethyl-3-oxocyclohexen-1-yl)amino]carbamoyl]phenyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 2352679 |
| Molecular Formula | C19H21N3O4S2 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.10 |
| IUPAC Name | N-[2-[[(5,5-dimethyl-3-oxocyclohexen-1-yl)amino]carbamoyl]phenyl]thiophene-2-sulfonamide |
| SMILES | CC1(C)CC(=O)C=C(NNC(=O)c2ccccc2NS(=O)(=O)c2cccs2)C1 |
| InChI | InChI=1S/C19H21N3O4S2/c1-19(2)11-13(10-14(23)12-19)20-21-18(24)15-6-3-4-7-16(15)22-28(25,26)17-8-5-9-27-17/h3-10,20,22H,11-12H2,1-2H3,(H,21,24) |
| InChIKey | FLINDFWQNIZTNI-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|