C20H25N3O3S2 — CID 42912536
2-(thiophen-2-ylsulfonylamino)-N-[(E)-(3,3,5-trimethylcyclohexylidene)amino]benzamide (PubChem CID 42912536) has the molecular formula C20H25N3O3S2 and a molecular weight of 419.57 g/mol. Its IUPAC name is 2-(thiophen-2-ylsulfonylamino)-N-[(E)-(3,3,5-trimethylcyclohexylidene)amino]benzamide.
| Compound Name | 2-(thiophen-2-ylsulfonylamino)-N-[(E)-(3,3,5-trimethylcyclohexylidene)amino]benzamide |
|---|---|
| PubChem CID | 42912536 |
| Molecular Formula | C20H25N3O3S2 |
| Molecular Weight | 419.57 g/mol |
| Exact Mass | 419.13 |
| IUPAC Name | 2-(thiophen-2-ylsulfonylamino)-N-[(E)-(3,3,5-trimethylcyclohexylidene)amino]benzamide |
| SMILES | CC1C/C(=N\NC(=O)c2ccccc2NS(=O)(=O)c2cccs2)CC(C)(C)C1 |
| InChI | InChI=1S/C20H25N3O3S2/c1-14-11-15(13-20(2,3)12-14)21-22-19(24)16-7-4-5-8-17(16)23-28(25,26)18-9-6-10-27-18/h4-10,14,23H,11-13H2,1-3H3,(H,22,24)/b21-15+ |
| InChIKey | YXQDSOVEQJAZGR-RCCKNPSSSA-N |
| XLogP | 4.48 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.57 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|