C19H17N5O6S2 — CID 27023469
N-[2-[[[2-(methylamino)-5-nitrobenzoyl]amino]carbamoyl]phenyl]thiophene-2-sulfonamide (PubChem CID 27023469) has the molecular formula C19H17N5O6S2 and a molecular weight of 475.51 g/mol. Its IUPAC name is N-[2-[[[2-(methylamino)-5-nitrobenzoyl]amino]carbamoyl]phenyl]thiophene-2-sulfonamide.
| Compound Name | N-[2-[[[2-(methylamino)-5-nitrobenzoyl]amino]carbamoyl]phenyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 27023469 |
| Molecular Formula | C19H17N5O6S2 |
| Molecular Weight | 475.51 g/mol |
| Exact Mass | 475.06 |
| IUPAC Name | N-[2-[[[2-(methylamino)-5-nitrobenzoyl]amino]carbamoyl]phenyl]thiophene-2-sulfonamide |
| SMILES | CNc1ccc([N+](=O)[O-])cc1C(=O)NNC(=O)c1ccccc1NS(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C19H17N5O6S2/c1-20-15-9-8-12(24(27)28)11-14(15)19(26)22-21-18(25)13-5-2-3-6-16(13)23-32(29,30)17-7-4-10-31-17/h2-11,20,23H,1H3,(H,21,25)(H,22,26) |
| InChIKey | YEJRAPWCMULQNR-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 159.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.51 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|