C20H23FN2O2 — CID 135614080
4-tert-butyl-N-[(E)-1-(5-fluoro-2-hydroxyphenyl)propylideneamino]benzamide (PubChem CID 135614080) has the molecular formula C20H23FN2O2 and a molecular weight of 342.41 g/mol. Its IUPAC name is 4-tert-butyl-N-[(E)-1-(5-fluoro-2-hydroxyphenyl)propylideneamino]benzamide.
| Compound Name | 4-tert-butyl-N-[(E)-1-(5-fluoro-2-hydroxyphenyl)propylideneamino]benzamide |
|---|---|
| PubChem CID | 135614080 |
| Molecular Formula | C20H23FN2O2 |
| Molecular Weight | 342.41 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | 4-tert-butyl-N-[(E)-1-(5-fluoro-2-hydroxyphenyl)propylideneamino]benzamide |
| SMILES | CC/C(=N\NC(=O)c1ccc(C(C)(C)C)cc1)c1cc(F)ccc1O |
| InChI | InChI=1S/C20H23FN2O2/c1-5-17(16-12-15(21)10-11-18(16)24)22-23-19(25)13-6-8-14(9-7-13)20(2,3)4/h6-12,24H,5H2,1-4H3,(H,23,25)/b22-17+ |
| InChIKey | FVGKWBUEGSNVED-OQKWZONESA-N |
| XLogP | 4.37 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.41 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|