C16H13Cl2FN2O2 — CID 3388426
N-[1-(3,5-dichloro-2-hydroxyphenyl)propylideneamino]-4-fluorobenzamide (PubChem CID 3388426) has the molecular formula C16H13Cl2FN2O2 and a molecular weight of 355.20 g/mol. Its IUPAC name is N-[1-(3,5-dichloro-2-hydroxyphenyl)propylideneamino]-4-fluorobenzamide.
| Compound Name | N-[1-(3,5-dichloro-2-hydroxyphenyl)propylideneamino]-4-fluorobenzamide |
|---|---|
| PubChem CID | 3388426 |
| Molecular Formula | C16H13Cl2FN2O2 |
| Molecular Weight | 355.20 g/mol |
| Exact Mass | 354.03 |
| IUPAC Name | N-[1-(3,5-dichloro-2-hydroxyphenyl)propylideneamino]-4-fluorobenzamide |
| SMILES | CCC(=NNC(=O)c1ccc(F)cc1)c1cc(Cl)cc(Cl)c1O |
| InChI | InChI=1S/C16H13Cl2FN2O2/c1-2-14(12-7-10(17)8-13(18)15(12)22)20-21-16(23)9-3-5-11(19)6-4-9/h3-8,22H,2H2,1H3,(H,21,23) |
| InChIKey | QWLMLNGREXFVGJ-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.20 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|