C18H13ClN4O6S2 — CID 4139970
N-[(5-chloro-2-hydroxy-3-nitrophenyl)methylideneamino]-2-(thiophen-2-ylsulfonylamino)benzamide (PubChem CID 4139970) has the molecular formula C18H13ClN4O6S2 and a molecular weight of 480.91 g/mol. Its IUPAC name is N-[(5-chloro-2-hydroxy-3-nitrophenyl)methylideneamino]-2-(thiophen-2-ylsulfonylamino)benzamide.
| Compound Name | N-[(5-chloro-2-hydroxy-3-nitrophenyl)methylideneamino]-2-(thiophen-2-ylsulfonylamino)benzamide |
|---|---|
| PubChem CID | 4139970 |
| Molecular Formula | C18H13ClN4O6S2 |
| Molecular Weight | 480.91 g/mol |
| Exact Mass | 480.00 |
| IUPAC Name | N-[(5-chloro-2-hydroxy-3-nitrophenyl)methylideneamino]-2-(thiophen-2-ylsulfonylamino)benzamide |
| SMILES | O=C(NN=Cc1cc(Cl)cc([N+](=O)[O-])c1O)c1ccccc1NS(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C18H13ClN4O6S2/c19-12-8-11(17(24)15(9-12)23(26)27)10-20-21-18(25)13-4-1-2-5-14(13)22-31(28,29)16-6-3-7-30-16/h1-10,22,24H,(H,21,25) |
| InChIKey | XCUZAOJYLVPYGX-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 151.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.91 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|