C13H10ClN3O4S — CID 171985513
N-[(Z)-(5-chloro-2-hydroxy-3-nitrophenyl)methylideneamino]-2-thiophen-2-ylacetamide (PubChem CID 171985513) has the molecular formula C13H10ClN3O4S and a molecular weight of 339.76 g/mol. Its IUPAC name is N-[(Z)-(5-chloro-2-hydroxy-3-nitrophenyl)methylideneamino]-2-thiophen-2-ylacetamide.
| Compound Name | N-[(Z)-(5-chloro-2-hydroxy-3-nitrophenyl)methylideneamino]-2-thiophen-2-ylacetamide |
|---|---|
| PubChem CID | 171985513 |
| Molecular Formula | C13H10ClN3O4S |
| Molecular Weight | 339.76 g/mol |
| Exact Mass | 339.01 |
| IUPAC Name | N-[(Z)-(5-chloro-2-hydroxy-3-nitrophenyl)methylideneamino]-2-thiophen-2-ylacetamide |
| SMILES | O=C(Cc1cccs1)N/N=C\c1cc(Cl)cc([N+](=O)[O-])c1O |
| InChI | InChI=1S/C13H10ClN3O4S/c14-9-4-8(13(19)11(5-9)17(20)21)7-15-16-12(18)6-10-2-1-3-22-10/h1-5,7,19H,6H2,(H,16,18)/b15-7- |
| InChIKey | VHGSTSCJBWUPLF-CHHVJCJISA-N |
| XLogP | 2.71 |
| TPSA | 104.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.76 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|