C14H11N3O5S — CID 6871748
N-[(E)-(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]-2-thiophen-2-ylacetamide (PubChem CID 6871748) has the molecular formula C14H11N3O5S and a molecular weight of 333.33 g/mol. Its IUPAC name is N-[(E)-(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]-2-thiophen-2-ylacetamide.
| Compound Name | N-[(E)-(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]-2-thiophen-2-ylacetamide |
|---|---|
| PubChem CID | 6871748 |
| Molecular Formula | C14H11N3O5S |
| Molecular Weight | 333.33 g/mol |
| Exact Mass | 333.04 |
| IUPAC Name | N-[(E)-(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]-2-thiophen-2-ylacetamide |
| SMILES | O=C(Cc1cccs1)N/N=C/c1cc2c(cc1[N+](=O)[O-])OCO2 |
| InChI | InChI=1S/C14H11N3O5S/c18-14(5-10-2-1-3-23-10)16-15-7-9-4-12-13(22-8-21-12)6-11(9)17(19)20/h1-4,6-7H,5,8H2,(H,16,18)/b15-7+ |
| InChIKey | PXIJENIUQBCSBN-VIZOYTHASA-N |
| XLogP | 2.08 |
| TPSA | 103.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.33 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|