C16H11BrN4O8 — CID 2179743
2-(4-bromo-2-nitrophenoxy)-N-[(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]acetamide (PubChem CID 2179743) has the molecular formula C16H11BrN4O8 and a molecular weight of 467.19 g/mol. Its IUPAC name is 2-(4-bromo-2-nitrophenoxy)-N-[(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]acetamide.
| Compound Name | 2-(4-bromo-2-nitrophenoxy)-N-[(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 2179743 |
| Molecular Formula | C16H11BrN4O8 |
| Molecular Weight | 467.19 g/mol |
| Exact Mass | 465.98 |
| IUPAC Name | 2-(4-bromo-2-nitrophenoxy)-N-[(6-nitro-1,3-benzodioxol-5-yl)methylideneamino]acetamide |
| SMILES | O=C(COc1ccc(Br)cc1[N+](=O)[O-])NN=Cc1cc2c(cc1[N+](=O)[O-])OCO2 |
| InChI | InChI=1S/C16H11BrN4O8/c17-10-1-2-13(12(4-10)21(25)26)27-7-16(22)19-18-6-9-3-14-15(29-8-28-14)5-11(9)20(23)24/h1-6H,7-8H2,(H,19,22) |
| InChIKey | MOWZGDLJWYYMIP-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 155.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.19 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|