C17H15BrN4O8 — CID 135613874
2-(4-bromo-2-nitrophenoxy)-N-[(E)-(3-ethoxy-2-hydroxy-5-nitrophenyl)methylideneamino]acetamide (PubChem CID 135613874) has the molecular formula C17H15BrN4O8 and a molecular weight of 483.23 g/mol. Its IUPAC name is 2-(4-bromo-2-nitrophenoxy)-N-[(E)-(3-ethoxy-2-hydroxy-5-nitrophenyl)methylideneamino]acetamide.
| Compound Name | 2-(4-bromo-2-nitrophenoxy)-N-[(E)-(3-ethoxy-2-hydroxy-5-nitrophenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 135613874 |
| Molecular Formula | C17H15BrN4O8 |
| Molecular Weight | 483.23 g/mol |
| Exact Mass | 482.01 |
| IUPAC Name | 2-(4-bromo-2-nitrophenoxy)-N-[(E)-(3-ethoxy-2-hydroxy-5-nitrophenyl)methylideneamino]acetamide |
| SMILES | CCOc1cc([N+](=O)[O-])cc(/C=N/NC(=O)COc2ccc(Br)cc2[N+](=O)[O-])c1O |
| InChI | InChI=1S/C17H15BrN4O8/c1-2-29-15-7-12(21(25)26)5-10(17(15)24)8-19-20-16(23)9-30-14-4-3-11(18)6-13(14)22(27)28/h3-8,24H,2,9H2,1H3,(H,20,23)/b19-8+ |
| InChIKey | LMKFGBILNYBYSR-UFWORHAWSA-N |
| XLogP | 2.90 |
| TPSA | 166.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.23 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|