C16H13BrN4O8 — CID 135420094
2-(4-bromo-2-methoxyphenoxy)-N-[(E)-(2-hydroxy-3,5-dinitrophenyl)methylideneamino]acetamide (PubChem CID 135420094) has the molecular formula C16H13BrN4O8 and a molecular weight of 469.20 g/mol. Its IUPAC name is 2-(4-bromo-2-methoxyphenoxy)-N-[(E)-(2-hydroxy-3,5-dinitrophenyl)methylideneamino]acetamide.
| Compound Name | 2-(4-bromo-2-methoxyphenoxy)-N-[(E)-(2-hydroxy-3,5-dinitrophenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 135420094 |
| Molecular Formula | C16H13BrN4O8 |
| Molecular Weight | 469.20 g/mol |
| Exact Mass | 467.99 |
| IUPAC Name | 2-(4-bromo-2-methoxyphenoxy)-N-[(E)-(2-hydroxy-3,5-dinitrophenyl)methylideneamino]acetamide |
| SMILES | COc1cc(Br)ccc1OCC(=O)N/N=C/c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1O |
| InChI | InChI=1S/C16H13BrN4O8/c1-28-14-5-10(17)2-3-13(14)29-8-15(22)19-18-7-9-4-11(20(24)25)6-12(16(9)23)21(26)27/h2-7,23H,8H2,1H3,(H,19,22)/b18-7+ |
| InChIKey | KWFWURFAKOZNQR-CNHKJKLMSA-N |
| XLogP | 2.51 |
| TPSA | 166.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.20 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|