C16H13N5O10 — CID 3340138
N-[(2-hydroxy-3-nitrophenyl)methylideneamino]-2-(2-methoxy-4,6-dinitrophenoxy)acetamide (PubChem CID 3340138) has the molecular formula C16H13N5O10 and a molecular weight of 435.31 g/mol. Its IUPAC name is N-[(2-hydroxy-3-nitrophenyl)methylideneamino]-2-(2-methoxy-4,6-dinitrophenoxy)acetamide.
| Compound Name | N-[(2-hydroxy-3-nitrophenyl)methylideneamino]-2-(2-methoxy-4,6-dinitrophenoxy)acetamide |
|---|---|
| PubChem CID | 3340138 |
| Molecular Formula | C16H13N5O10 |
| Molecular Weight | 435.31 g/mol |
| Exact Mass | 435.07 |
| IUPAC Name | N-[(2-hydroxy-3-nitrophenyl)methylideneamino]-2-(2-methoxy-4,6-dinitrophenoxy)acetamide |
| SMILES | COc1cc([N+](=O)[O-])cc([N+](=O)[O-])c1OCC(=O)NN=Cc1cccc([N+](=O)[O-])c1O |
| InChI | InChI=1S/C16H13N5O10/c1-30-13-6-10(19(24)25)5-12(21(28)29)16(13)31-8-14(22)18-17-7-9-3-2-4-11(15(9)23)20(26)27/h2-7,23H,8H2,1H3,(H,18,22) |
| InChIKey | WAZRUXVCTREKGM-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 209.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.31 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|