C17H16N4O9 — CID 136720692
N-[(Z)-(2-hydroxy-4-methoxyphenyl)methylideneamino]-2-(2-methoxy-4,6-dinitrophenoxy)acetamide (PubChem CID 136720692) has the molecular formula C17H16N4O9 and a molecular weight of 420.33 g/mol. Its IUPAC name is N-[(Z)-(2-hydroxy-4-methoxyphenyl)methylideneamino]-2-(2-methoxy-4,6-dinitrophenoxy)acetamide.
| Compound Name | N-[(Z)-(2-hydroxy-4-methoxyphenyl)methylideneamino]-2-(2-methoxy-4,6-dinitrophenoxy)acetamide |
|---|---|
| PubChem CID | 136720692 |
| Molecular Formula | C17H16N4O9 |
| Molecular Weight | 420.33 g/mol |
| Exact Mass | 420.09 |
| IUPAC Name | N-[(Z)-(2-hydroxy-4-methoxyphenyl)methylideneamino]-2-(2-methoxy-4,6-dinitrophenoxy)acetamide |
| SMILES | COc1ccc(/C=N\NC(=O)COc2c(OC)cc([N+](=O)[O-])cc2[N+](=O)[O-])c(O)c1 |
| InChI | InChI=1S/C17H16N4O9/c1-28-12-4-3-10(14(22)7-12)8-18-19-16(23)9-30-17-13(21(26)27)5-11(20(24)25)6-15(17)29-2/h3-8,22H,9H2,1-2H3,(H,19,23)/b18-8- |
| InChIKey | AWYVXWCZUPODKN-LSCVHKIXSA-N |
| XLogP | 1.75 |
| TPSA | 175.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.33 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|