C16H12Br3N3O6 — CID 135504212
N-[(E)-(2-hydroxy-3-methoxy-5-nitrophenyl)methylideneamino]-2-(2,4,6-tribromophenoxy)acetamide (PubChem CID 135504212) has the molecular formula C16H12Br3N3O6 and a molecular weight of 582.00 g/mol. Its IUPAC name is N-[(E)-(2-hydroxy-3-methoxy-5-nitrophenyl)methylideneamino]-2-(2,4,6-tribromophenoxy)acetamide.
| Compound Name | N-[(E)-(2-hydroxy-3-methoxy-5-nitrophenyl)methylideneamino]-2-(2,4,6-tribromophenoxy)acetamide |
|---|---|
| PubChem CID | 135504212 |
| Molecular Formula | C16H12Br3N3O6 |
| Molecular Weight | 582.00 g/mol |
| Exact Mass | 578.83 |
| IUPAC Name | N-[(E)-(2-hydroxy-3-methoxy-5-nitrophenyl)methylideneamino]-2-(2,4,6-tribromophenoxy)acetamide |
| SMILES | COc1cc([N+](=O)[O-])cc(/C=N/NC(=O)COc2c(Br)cc(Br)cc2Br)c1O |
| InChI | InChI=1S/C16H12Br3N3O6/c1-27-13-5-10(22(25)26)2-8(15(13)24)6-20-21-14(23)7-28-16-11(18)3-9(17)4-12(16)19/h2-6,24H,7H2,1H3,(H,21,23)/b20-6+ |
| InChIKey | BYDHAFRQQPEPFY-CGOBSMCZSA-N |
| XLogP | 4.13 |
| TPSA | 123.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.00 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|