C12H11N7O7 — CID 136919391
N-[(Z)-(2-hydroxy-3-methoxy-5-nitrophenyl)methylideneamino]-2-(3-nitro-1,2,4-triazol-1-yl)acetamide (PubChem CID 136919391) has the molecular formula C12H11N7O7 and a molecular weight of 365.26 g/mol. Its IUPAC name is N-[(Z)-(2-hydroxy-3-methoxy-5-nitrophenyl)methylideneamino]-2-(3-nitro-1,2,4-triazol-1-yl)acetamide.
| Compound Name | N-[(Z)-(2-hydroxy-3-methoxy-5-nitrophenyl)methylideneamino]-2-(3-nitro-1,2,4-triazol-1-yl)acetamide |
|---|---|
| PubChem CID | 136919391 |
| Molecular Formula | C12H11N7O7 |
| Molecular Weight | 365.26 g/mol |
| Exact Mass | 365.07 |
| IUPAC Name | N-[(Z)-(2-hydroxy-3-methoxy-5-nitrophenyl)methylideneamino]-2-(3-nitro-1,2,4-triazol-1-yl)acetamide |
| SMILES | COc1cc([N+](=O)[O-])cc(/C=N\NC(=O)Cn2cnc([N+](=O)[O-])n2)c1O |
| InChI | InChI=1S/C12H11N7O7/c1-26-9-3-8(18(22)23)2-7(11(9)21)4-14-15-10(20)5-17-6-13-12(16-17)19(24)25/h2-4,6,21H,5H2,1H3,(H,15,20)/b14-4- |
| InChIKey | ZCSVPXBCXQXINN-CPSFFCFKSA-N |
| XLogP | -0.04 |
| TPSA | 187.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.26 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|