C17H16N6O5 — CID 136897203
3-(benzotriazol-1-yl)-N-[(Z)-(2-hydroxy-3-methoxy-5-nitrophenyl)methylideneamino]propanamide (PubChem CID 136897203) has the molecular formula C17H16N6O5 and a molecular weight of 384.35 g/mol. Its IUPAC name is 3-(benzotriazol-1-yl)-N-[(Z)-(2-hydroxy-3-methoxy-5-nitrophenyl)methylideneamino]propanamide.
| Compound Name | 3-(benzotriazol-1-yl)-N-[(Z)-(2-hydroxy-3-methoxy-5-nitrophenyl)methylideneamino]propanamide |
|---|---|
| PubChem CID | 136897203 |
| Molecular Formula | C17H16N6O5 |
| Molecular Weight | 384.35 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | 3-(benzotriazol-1-yl)-N-[(Z)-(2-hydroxy-3-methoxy-5-nitrophenyl)methylideneamino]propanamide |
| SMILES | COc1cc([N+](=O)[O-])cc(/C=N\NC(=O)CCn2nnc3ccccc32)c1O |
| InChI | InChI=1S/C17H16N6O5/c1-28-15-9-12(23(26)27)8-11(17(15)25)10-18-20-16(24)6-7-22-14-5-3-2-4-13(14)19-21-22/h2-5,8-10,25H,6-7H2,1H3,(H,20,24)/b18-10- |
| InChIKey | ZOMIMBFBEGBGSN-ZDLGFXPLSA-N |
| XLogP | 1.59 |
| TPSA | 144.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.35 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|