C13H12BrN5O5 — CID 3267873
4-bromo-N-[(2-hydroxy-3-methoxy-5-nitrophenyl)methylideneamino]-1-methylpyrazole-3-carboxamide (PubChem CID 3267873) has the molecular formula C13H12BrN5O5 and a molecular weight of 398.17 g/mol. Its IUPAC name is 4-bromo-N-[(2-hydroxy-3-methoxy-5-nitrophenyl)methylideneamino]-1-methylpyrazole-3-carboxamide.
| Compound Name | 4-bromo-N-[(2-hydroxy-3-methoxy-5-nitrophenyl)methylideneamino]-1-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 3267873 |
| Molecular Formula | C13H12BrN5O5 |
| Molecular Weight | 398.17 g/mol |
| Exact Mass | 397.00 |
| IUPAC Name | 4-bromo-N-[(2-hydroxy-3-methoxy-5-nitrophenyl)methylideneamino]-1-methylpyrazole-3-carboxamide |
| SMILES | COc1cc([N+](=O)[O-])cc(C=NNC(=O)c2nn(C)cc2Br)c1O |
| InChI | InChI=1S/C13H12BrN5O5/c1-18-6-9(14)11(17-18)13(21)16-15-5-7-3-8(19(22)23)4-10(24-2)12(7)20/h3-6,20H,1-2H3,(H,16,21) |
| InChIKey | MBALCWNFWVXXKP-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 131.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.17 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|