C19H15BrN6O7 — CID 136668313
1-[(3-bromophenyl)methyl]-N-[(Z)-(2-hydroxy-3-methoxy-5-nitrophenyl)methylideneamino]-4-nitropyrazole-3-carboxamide (PubChem CID 136668313) has the molecular formula C19H15BrN6O7 and a molecular weight of 519.27 g/mol. Its IUPAC name is 1-[(3-bromophenyl)methyl]-N-[(Z)-(2-hydroxy-3-methoxy-5-nitrophenyl)methylideneamino]-4-nitropyrazole-3-carboxamide.
| Compound Name | 1-[(3-bromophenyl)methyl]-N-[(Z)-(2-hydroxy-3-methoxy-5-nitrophenyl)methylideneamino]-4-nitropyrazole-3-carboxamide |
|---|---|
| PubChem CID | 136668313 |
| Molecular Formula | C19H15BrN6O7 |
| Molecular Weight | 519.27 g/mol |
| Exact Mass | 518.02 |
| IUPAC Name | 1-[(3-bromophenyl)methyl]-N-[(Z)-(2-hydroxy-3-methoxy-5-nitrophenyl)methylideneamino]-4-nitropyrazole-3-carboxamide |
| SMILES | COc1cc([N+](=O)[O-])cc(/C=N\NC(=O)c2nn(Cc3cccc(Br)c3)cc2[N+](=O)[O-])c1O |
| InChI | InChI=1S/C19H15BrN6O7/c1-33-16-7-14(25(29)30)6-12(18(16)27)8-21-22-19(28)17-15(26(31)32)10-24(23-17)9-11-3-2-4-13(20)5-11/h2-8,10,27H,9H2,1H3,(H,22,28)/b21-8- |
| InChIKey | QAZJTFOXWPAWEG-WNFQYIGGSA-N |
| XLogP | 2.99 |
| TPSA | 175.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.27 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|