C18H13BrFN5O3 — CID 1275474
1-[(3-bromophenyl)methyl]-N-[(2-fluorophenyl)methylideneamino]-4-nitropyrazole-3-carboxamide (PubChem CID 1275474) has the molecular formula C18H13BrFN5O3 and a molecular weight of 446.24 g/mol. Its IUPAC name is 1-[(3-bromophenyl)methyl]-N-[(2-fluorophenyl)methylideneamino]-4-nitropyrazole-3-carboxamide.
| Compound Name | 1-[(3-bromophenyl)methyl]-N-[(2-fluorophenyl)methylideneamino]-4-nitropyrazole-3-carboxamide |
|---|---|
| PubChem CID | 1275474 |
| Molecular Formula | C18H13BrFN5O3 |
| Molecular Weight | 446.24 g/mol |
| Exact Mass | 445.02 |
| IUPAC Name | 1-[(3-bromophenyl)methyl]-N-[(2-fluorophenyl)methylideneamino]-4-nitropyrazole-3-carboxamide |
| SMILES | O=C(NN=Cc1ccccc1F)c1nn(Cc2cccc(Br)c2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H13BrFN5O3/c19-14-6-3-4-12(8-14)10-24-11-16(25(27)28)17(23-24)18(26)22-21-9-13-5-1-2-7-15(13)20/h1-9,11H,10H2,(H,22,26) |
| InChIKey | YMXVAWPNVVGXOM-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 102.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.24 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|