C21H20BrN5O6 — CID 5499935
1-[(4-bromophenyl)methyl]-4-nitro-N-[(Z)-(3,4,5-trimethoxyphenyl)methylideneamino]pyrazole-3-carboxamide (PubChem CID 5499935) has the molecular formula C21H20BrN5O6 and a molecular weight of 518.32 g/mol. Its IUPAC name is 1-[(4-bromophenyl)methyl]-4-nitro-N-[(Z)-(3,4,5-trimethoxyphenyl)methylideneamino]pyrazole-3-carboxamide.
| Compound Name | 1-[(4-bromophenyl)methyl]-4-nitro-N-[(Z)-(3,4,5-trimethoxyphenyl)methylideneamino]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 5499935 |
| Molecular Formula | C21H20BrN5O6 |
| Molecular Weight | 518.32 g/mol |
| Exact Mass | 517.06 |
| IUPAC Name | 1-[(4-bromophenyl)methyl]-4-nitro-N-[(Z)-(3,4,5-trimethoxyphenyl)methylideneamino]pyrazole-3-carboxamide |
| SMILES | COc1cc(/C=N\NC(=O)c2nn(Cc3ccc(Br)cc3)cc2[N+](=O)[O-])cc(OC)c1OC |
| InChI | InChI=1S/C21H20BrN5O6/c1-31-17-8-14(9-18(32-2)20(17)33-3)10-23-24-21(28)19-16(27(29)30)12-26(25-19)11-13-4-6-15(22)7-5-13/h4-10,12H,11H2,1-3H3,(H,24,28)/b23-10- |
| InChIKey | FOUQAQARDYNBRJ-RMORIDSASA-N |
| XLogP | 3.39 |
| TPSA | 130.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.32 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|