C18H13Br2N5O3 — CID 1272073
4-bromo-1-[(4-bromophenyl)methyl]-N-[(4-nitrophenyl)methylideneamino]pyrazole-3-carboxamide (PubChem CID 1272073) has the molecular formula C18H13Br2N5O3 and a molecular weight of 507.14 g/mol. Its IUPAC name is 4-bromo-1-[(4-bromophenyl)methyl]-N-[(4-nitrophenyl)methylideneamino]pyrazole-3-carboxamide.
| Compound Name | 4-bromo-1-[(4-bromophenyl)methyl]-N-[(4-nitrophenyl)methylideneamino]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 1272073 |
| Molecular Formula | C18H13Br2N5O3 |
| Molecular Weight | 507.14 g/mol |
| Exact Mass | 504.94 |
| IUPAC Name | 4-bromo-1-[(4-bromophenyl)methyl]-N-[(4-nitrophenyl)methylideneamino]pyrazole-3-carboxamide |
| SMILES | O=C(NN=Cc1ccc([N+](=O)[O-])cc1)c1nn(Cc2ccc(Br)cc2)cc1Br |
| InChI | InChI=1S/C18H13Br2N5O3/c19-14-5-1-13(2-6-14)10-24-11-16(20)17(23-24)18(26)22-21-9-12-3-7-15(8-4-12)25(27)28/h1-9,11H,10H2,(H,22,26) |
| InChIKey | RAVBNOYXOXOUEA-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 102.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.14 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|