C22H14BrClN6O6 — CID 3950946
4-bromo-N-[[5-(2-chloro-5-nitrophenyl)furan-2-yl]methylideneamino]-1-[(4-nitrophenyl)methyl]pyrazole-3-carboxamide (PubChem CID 3950946) has the molecular formula C22H14BrClN6O6 and a molecular weight of 573.75 g/mol. Its IUPAC name is 4-bromo-N-[[5-(2-chloro-5-nitrophenyl)furan-2-yl]methylideneamino]-1-[(4-nitrophenyl)methyl]pyrazole-3-carboxamide.
| Compound Name | 4-bromo-N-[[5-(2-chloro-5-nitrophenyl)furan-2-yl]methylideneamino]-1-[(4-nitrophenyl)methyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 3950946 |
| Molecular Formula | C22H14BrClN6O6 |
| Molecular Weight | 573.75 g/mol |
| Exact Mass | 571.98 |
| IUPAC Name | 4-bromo-N-[[5-(2-chloro-5-nitrophenyl)furan-2-yl]methylideneamino]-1-[(4-nitrophenyl)methyl]pyrazole-3-carboxamide |
| SMILES | O=C(NN=Cc1ccc(-c2cc([N+](=O)[O-])ccc2Cl)o1)c1nn(Cc2ccc([N+](=O)[O-])cc2)cc1Br |
| InChI | InChI=1S/C22H14BrClN6O6/c23-18-12-28(11-13-1-3-14(4-2-13)29(32)33)27-21(18)22(31)26-25-10-16-6-8-20(36-16)17-9-15(30(34)35)5-7-19(17)24/h1-10,12H,11H2,(H,26,31) |
| InChIKey | KTQXVHMCOQCHHU-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 158.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.75 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|