C18H12Br3N5O4 — CID 135788525
4-bromo-N-[(E)-(3,5-dibromo-4-hydroxyphenyl)methylideneamino]-1-[(4-nitrophenyl)methyl]pyrazole-3-carboxamide (PubChem CID 135788525) has the molecular formula C18H12Br3N5O4 and a molecular weight of 602.04 g/mol. Its IUPAC name is 4-bromo-N-[(E)-(3,5-dibromo-4-hydroxyphenyl)methylideneamino]-1-[(4-nitrophenyl)methyl]pyrazole-3-carboxamide.
| Compound Name | 4-bromo-N-[(E)-(3,5-dibromo-4-hydroxyphenyl)methylideneamino]-1-[(4-nitrophenyl)methyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 135788525 |
| Molecular Formula | C18H12Br3N5O4 |
| Molecular Weight | 602.04 g/mol |
| Exact Mass | 598.84 |
| IUPAC Name | 4-bromo-N-[(E)-(3,5-dibromo-4-hydroxyphenyl)methylideneamino]-1-[(4-nitrophenyl)methyl]pyrazole-3-carboxamide |
| SMILES | O=C(N/N=C/c1cc(Br)c(O)c(Br)c1)c1nn(Cc2ccc([N+](=O)[O-])cc2)cc1Br |
| InChI | InChI=1S/C18H12Br3N5O4/c19-13-5-11(6-14(20)17(13)27)7-22-23-18(28)16-15(21)9-25(24-16)8-10-1-3-12(4-2-10)26(29)30/h1-7,9,27H,8H2,(H,23,28)/b22-7+ |
| InChIKey | NNIPIUFAKZCVOE-QPJQQBGISA-N |
| XLogP | 4.60 |
| TPSA | 122.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.04 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|