C18H14BrClN4O2 — CID 1275394
4-bromo-1-[(4-chlorophenyl)methyl]-N-[(2-hydroxyphenyl)methylideneamino]pyrazole-3-carboxamide (PubChem CID 1275394) has the molecular formula C18H14BrClN4O2 and a molecular weight of 433.69 g/mol. Its IUPAC name is 4-bromo-1-[(4-chlorophenyl)methyl]-N-[(2-hydroxyphenyl)methylideneamino]pyrazole-3-carboxamide.
| Compound Name | 4-bromo-1-[(4-chlorophenyl)methyl]-N-[(2-hydroxyphenyl)methylideneamino]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 1275394 |
| Molecular Formula | C18H14BrClN4O2 |
| Molecular Weight | 433.69 g/mol |
| Exact Mass | 432.00 |
| IUPAC Name | 4-bromo-1-[(4-chlorophenyl)methyl]-N-[(2-hydroxyphenyl)methylideneamino]pyrazole-3-carboxamide |
| SMILES | O=C(NN=Cc1ccccc1O)c1nn(Cc2ccc(Cl)cc2)cc1Br |
| InChI | InChI=1S/C18H14BrClN4O2/c19-15-11-24(10-12-5-7-14(20)8-6-12)23-17(15)18(26)22-21-9-13-3-1-2-4-16(13)25/h1-9,11,25H,10H2,(H,22,26) |
| InChIKey | KMNDYJNSVSPCCL-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.69 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|