C19H15Br2ClN4O2 — CID 1275461
4-bromo-N-[(5-bromo-2-methoxyphenyl)methylideneamino]-1-[(4-chlorophenyl)methyl]pyrazole-3-carboxamide (PubChem CID 1275461) has the molecular formula C19H15Br2ClN4O2 and a molecular weight of 526.62 g/mol. Its IUPAC name is 4-bromo-N-[(5-bromo-2-methoxyphenyl)methylideneamino]-1-[(4-chlorophenyl)methyl]pyrazole-3-carboxamide.
| Compound Name | 4-bromo-N-[(5-bromo-2-methoxyphenyl)methylideneamino]-1-[(4-chlorophenyl)methyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 1275461 |
| Molecular Formula | C19H15Br2ClN4O2 |
| Molecular Weight | 526.62 g/mol |
| Exact Mass | 523.93 |
| IUPAC Name | 4-bromo-N-[(5-bromo-2-methoxyphenyl)methylideneamino]-1-[(4-chlorophenyl)methyl]pyrazole-3-carboxamide |
| SMILES | COc1ccc(Br)cc1C=NNC(=O)c1nn(Cc2ccc(Cl)cc2)cc1Br |
| InChI | InChI=1S/C19H15Br2ClN4O2/c1-28-17-7-4-14(20)8-13(17)9-23-24-19(27)18-16(21)11-26(25-18)10-12-2-5-15(22)6-3-12/h2-9,11H,10H2,1H3,(H,24,27) |
| InChIKey | IASXNWMKKNTNNF-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 68.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.62 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|