C18H14BrN5O4 — CID 1275370
4-bromo-N-[(4-hydroxyphenyl)methylideneamino]-1-[(4-nitrophenyl)methyl]pyrazole-3-carboxamide (PubChem CID 1275370) has the molecular formula C18H14BrN5O4 and a molecular weight of 444.25 g/mol. Its IUPAC name is 4-bromo-N-[(4-hydroxyphenyl)methylideneamino]-1-[(4-nitrophenyl)methyl]pyrazole-3-carboxamide.
| Compound Name | 4-bromo-N-[(4-hydroxyphenyl)methylideneamino]-1-[(4-nitrophenyl)methyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 1275370 |
| Molecular Formula | C18H14BrN5O4 |
| Molecular Weight | 444.25 g/mol |
| Exact Mass | 443.02 |
| IUPAC Name | 4-bromo-N-[(4-hydroxyphenyl)methylideneamino]-1-[(4-nitrophenyl)methyl]pyrazole-3-carboxamide |
| SMILES | O=C(NN=Cc1ccc(O)cc1)c1nn(Cc2ccc([N+](=O)[O-])cc2)cc1Br |
| InChI | InChI=1S/C18H14BrN5O4/c19-16-11-23(10-13-1-5-14(6-2-13)24(27)28)22-17(16)18(26)21-20-9-12-3-7-15(25)8-4-12/h1-9,11,25H,10H2,(H,21,26) |
| InChIKey | UKJWDQXJLQDMJN-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 122.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.25 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|