C21H18BrClN4O — CID 6343388
4-bromo-1-[(4-chlorophenyl)methyl]-N-[(Z)-[(E)-4-phenylbut-3-en-2-ylidene]amino]pyrazole-3-carboxamide (PubChem CID 6343388) has the molecular formula C21H18BrClN4O and a molecular weight of 457.76 g/mol. Its IUPAC name is 4-bromo-1-[(4-chlorophenyl)methyl]-N-[(Z)-[(E)-4-phenylbut-3-en-2-ylidene]amino]pyrazole-3-carboxamide.
| Compound Name | 4-bromo-1-[(4-chlorophenyl)methyl]-N-[(Z)-[(E)-4-phenylbut-3-en-2-ylidene]amino]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 6343388 |
| Molecular Formula | C21H18BrClN4O |
| Molecular Weight | 457.76 g/mol |
| Exact Mass | 456.04 |
| IUPAC Name | 4-bromo-1-[(4-chlorophenyl)methyl]-N-[(Z)-[(E)-4-phenylbut-3-en-2-ylidene]amino]pyrazole-3-carboxamide |
| SMILES | CC(/C=C/c1ccccc1)=N/NC(=O)c1nn(Cc2ccc(Cl)cc2)cc1Br |
| InChI | InChI=1S/C21H18BrClN4O/c1-15(7-8-16-5-3-2-4-6-16)24-25-21(28)20-19(22)14-27(26-20)13-17-9-11-18(23)12-10-17/h2-12,14H,13H2,1H3,(H,25,28)/b8-7+,24-15- |
| InChIKey | KCOQNAGACPOTJW-JXMKQCPDSA-N |
| XLogP | 5.17 |
| TPSA | 59.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.76 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|